
CAS 1224944-44-8
:3-Iodopyrazolo[1,5-a]pyrimidin-5(4H)-one
Description:
3-Iodopyrazolo[1,5-a]pyrimidin-5(4H)-one is a heterocyclic compound characterized by its unique pyrazolo and pyrimidinone structures. This compound features an iodine atom at the 3-position of the pyrazolo ring, which can influence its reactivity and biological activity. The presence of the carbonyl group in the pyrimidinone moiety contributes to its potential as a pharmacophore in medicinal chemistry. The molecular structure suggests that it may exhibit interesting properties such as potential anti-inflammatory or anticancer activities, although specific biological data would be necessary to confirm these effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the iodine substituent, which may also affect its interactions with biological targets. As a synthetic intermediate, it may serve as a building block for the development of more complex molecules in drug discovery. Overall, 3-Iodopyrazolo[1,5-a]pyrimidin-5(4H)-one represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C6H4IN3O
InChI:InChI=1S/C6H4IN3O/c7-4-3-8-10-2-1-5(11)9-6(4)10/h1-3H,(H,9,11)
InChI key:InChIKey=BOKYVRXAEQEKHL-UHFFFAOYSA-N
SMILES:IC1=C2N(C=CC(=O)N2)N=C1
Synonyms:- 3-Iodo-4H,5H-pyrazolo[1,5-a]pyrimidin-5-one
- 3-Iodopyrazolo[1,5-a]pyrimidin-5-ol
- Pyrazolo[1,5-a]pyrimidin-5(4H)-one, 3-iodo-
- 3-Iodopyrazolo[1,5-a]pyrimidin-5(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.