CAS 1225071-45-3

1′,4′-Dihydro-2′-(2-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid

Description:

1′,4′-Dihydro-2′-(2-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of cyclohexane and isoquinoline. This compound features a dihydroisoquinoline moiety, indicating it possesses a fused bicyclic system that contributes to its potential biological activity. The presence of a carboxylic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The 2-methylpropyl substituent adds to the compound's steric bulk, which can affect its interaction with biological targets. Additionally, the compound's structural complexity may lead to interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 1225071-45-3, allows for precise identification in chemical databases, facilitating studies related to its synthesis, characterization, and potential applications in drug development or other fields of chemistry.

Formula: C₁₉H₂₅NO₃

InChI: InChI=1S/C19H25NO3/c1-13(2)12-20-17(21)15-9-5-4-8-14(15)16(18(22)23)19(20)10-6-3-7-11-19/h4-5,8-9,13,16H,3,6-7,10-12H2,1-2H3,(H,22,23)

InChI key: InChIKey=YDGATRMZEMWJAW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2(N(CC(C)C)C(=O)C=3C1=CC=CC3)CCCCC2

Synonyms:

• Spiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid, 1′,4′-dihydro-2′-(2-methylpropyl)-1′-oxo-
• 1′,4′-Dihydro-2′-(2-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid