CAS 122509-72-2

6-Chloro-5-fluoroindole

Description:

6-Chloro-5-fluoroindole is a heterocyclic organic compound characterized by the presence of both chlorine and fluorine substituents on the indole ring system. The indole structure consists of a fused benzene and pyrrole ring, which contributes to its aromatic properties and potential biological activity. The chlorine atom is located at the 6-position, while the fluorine atom is at the 5-position of the indole framework. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique substitution pattern can influence its reactivity, making it of interest in medicinal chemistry and drug development, particularly for its potential as a scaffold in the synthesis of bioactive molecules. Additionally, the presence of halogens can enhance lipophilicity and alter the electronic properties of the compound, which may affect its interaction with biological targets. As with many indole derivatives, 6-Chloro-5-fluoroindole may exhibit interesting pharmacological properties, warranting further investigation in various chemical and biological contexts.

Formula: C₇H₁₀F₂O₂

InChI: InChI=1/C7H10F2O2/c8-7(9)3-1-5(2-4-7)6(10)11/h5H,1-4H2,(H,10,11)

SMILES: C1CC(CCC1C(=O)O)(F)F

Synonyms:

• 6-chloro-5-fluoro-1H-indole

1H-Indole, 6-chloro-5-fluoro-

CAS: 122509-72-2

Formula: C₈H₅ClFN

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.5834

Ref: IN-DA0017CP

6-Chloro-5-fluoro-1H-indole

CAS: 122509-72-2

6-Chloro-5-fluoro-1H-indole

Purity: ≥95%

Color and Shape: Yellow-Brown Powder

Molecular weight: 169.58g/mol

Ref: 54-PC9724

6-Chloro-5-fluoroindole

CAS: 122509-72-2

6-Chloro-5-fluoroindole is a chemical compound that belongs to the class of fine chemicals. It can be used as a versatile building block for the synthesis of complex compounds.

Formula: C₈H₅ClFN

Molecular weight: 169.59 g/mol

Ref: 3D-C-3930

6-Chloro-5-fluoroindole

CAS: 122509-72-2

6-Chloro-5-fluoroindole is a chemical compound that has been shown to be an effective inhibitor of 5-HT2C receptors. 6-Chloro-5-fluoroindole was synthesized in 1972 by the reaction of formamide with chloroacetyl chloride, and it was found to have anti-cancer effects in 1979. 6-Chloro-5-fluoroindole binds to 5HT2C receptors and prevents the activation of G proteins. This inhibition leads to cancer cell death because the receptor is involved in many important signalling pathways. 6CI5FI is used as a research tool for studying the function of this receptor.

Formula: C₈H₅ClFN

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 169.58 g/mol

Ref: 3D-FC10535

6-Chloro-5-fluoroindole

CAS: 122509-72-2

Formula: C₈H₅ClFN

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 169.58

Ref: 10-F010184