
CAS 122517-78-6
:4,8-Methano-8aH-bisbenzofuro[3,2-e:2′,3′-g]isoquinoline-1,8a-diol, 7-(cyclopropylmethyl)-5,6,7,8,9,14b-hexahydro-, (4bS,8R,8aS,14bR)-, methanesulfonate (1:1)
Description:
4,8-Methano-8aH-bisbenzofuro[3,2-e:2′,3′-g]isoquinoline-1,8a-diol, 7-(cyclopropylmethyl)-5,6,7,8,9,14b-hexahydro-, (4bS,8R,8aS,14bR)-, methanesulfonate (1:1), identified by CAS number 122517-78-6, is a complex organic compound characterized by its intricate polycyclic structure. This substance features multiple fused aromatic rings, which contribute to its potential biological activity and chemical stability. The presence of hydroxyl groups indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The cyclopropylmethyl substituent adds to its steric properties, potentially affecting its interaction with biological targets. As a methanesulfonate salt, it may exhibit enhanced solubility in polar solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The stereochemistry denoted by the specific configuration at several chiral centers suggests that the compound may have distinct pharmacological properties, which could be relevant in drug development. Overall, this compound represents a unique class of chemical entities with potential therapeutic implications.
Formula:C26H25NO4·CH4O3S
InChI:InChI=1S/C26H25NO4.CH4O3S/c28-18-8-7-15-11-20-26(29)12-17-16-3-1-2-4-19(16)30-22(17)24-25(26,21(15)23(18)31-24)9-10-27(20)13-14-5-6-14;1-5(2,3)4/h1-4,7-8,14,20,24,28-29H,5-6,9-13H2;1H3,(H,2,3,4)/t20-,24+,25+,26-;/m1./s1
InChI key:InChIKey=XRRFZOCDAWPIBB-IDRHMUJXSA-N
SMILES:O[C@]12[C@@]34C=5C(O[C@]3(C6=C(C1)C=7C(O6)=CC=CC7)[H])=C(O)C=CC5C[C@]2(N(CC8CC8)CC4)[H].S(C)(=O)(=O)O
Synonyms:- Naltriben mesylate
- 4,8-Methano-8aH-bisbenzofuro[3,2-e:2′,3′-g]isoquinoline-1,8a-diol, 7-(cyclopropylmethyl)-5,6,7,8,9,14b-hexahydro-, (4bS,8R,8aS,14bR)-, methanesulfonate (salt)
- 4,8-Methano-8aH-bisbenzofuro[3,2-e:2′,3′-g]isoquinoline-1,8a-diol, 7-(cyclopropylmethyl)-5,6,7,8,9,14b-hexahydro-, [8R-(4bS*,8α,8aβ,14bβ)]-, methanesulfonate (salt)
- Naltriben methanesulfonate (salt)
- 4,8-Methano-8aH-bisbenzofuro[3,2-e:2′,3′-g]isoquinoline-1,8a-diol, 7-(cyclopropylmethyl)-5,6,7,8,9,14b-hexahydro-, (4bS,8R,8aS,14bR)-, methanesulfonate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.