CAS 122520-79-0
:2-Propenoic acid, 2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)- (9CI)
Description:
2-Propenoic acid, 2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)-, also known by its CAS number 122520-79-0, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a cyano group attached to a phenolic structure. This compound features a double bond in the propenoic acid part, indicating its potential for polymerization and reactivity in various chemical processes. The presence of the cyano group contributes to its reactivity and may influence its biological activity, while the dihydroxyphenyl group suggests potential antioxidant properties. The compound is likely to be soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. Its unique structure may make it of interest in fields such as medicinal chemistry, materials science, or organic synthesis, where it could serve as a building block or a functional material. However, specific applications and safety data would require further investigation into its properties and behavior in various environments.
Formula:C10H7NO4
InChI:InChI=1/C10H7NO4/c11-5-7(10(14)15)3-6-1-2-8(12)9(13)4-6/h1-4,12-13H,(H,14,15)/b7-3+
Synonyms:- Tyrphostin AG 30
- (2E)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Propenoic acid, 2-cyano-3-(3,4-dihydroxyphenyl)-, (2E)- (9CI)
CAS:Formula:C10H7NO4Purity:99%Color and Shape:SolidMolecular weight:205.1669(E)-2-Cyano-3-(3,4-Dihydroxyphenyl)Acrylic Acid
CAS:(E)-2-Cyano-3-(3,4-Dihydroxyphenyl)Acrylic AcidPurity:98%Molecular weight:205.17g/molTyrphostin AG30
CAS:<p>Tyrphostin AG30 (AG30) (AG30) is a potent protein tyrosine kinases (PTK) inhibitor.</p>Formula:C10H7NO4Purity:99.02%Color and Shape:SolidMolecular weight:205.17(E)-2-Cyano-3-(3,4-dihydroxyphenyl)acrylic acid
CAS:Formula:C10H7NO4Purity:99%Molecular weight:205.169



