CAS 122520-80-3
:2-[1-(4-Aminophenyl)ethylidene]propanedinitrile
Description:
2-[1-(4-Aminophenyl)ethylidene]propanedinitrile, with the CAS number 122520-80-3, is an organic compound characterized by its unique structure, which includes a propanedinitrile backbone and an ethylidene group substituted with a para-aminophenyl moiety. This compound typically exhibits properties associated with nitriles, such as high polarity and potential reactivity due to the presence of the cyano groups. The amino group in the para position can influence its solubility and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the presence of the aromatic ring may impart stability and contribute to its electronic properties. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing more complex molecules. However, specific applications and safety considerations would depend on further research and characterization.
Formula:C11H9N3
InChI:InChI=1S/C11H9N3/c1-8(10(6-12)7-13)9-2-4-11(14)5-3-9/h2-5H,14H2,1H3
InChI key:InChIKey=UDNNQFHSLNHDGH-UHFFFAOYSA-N
SMILES:C(=C(C#N)C#N)(C)C1=CC=C(N)C=C1
Synonyms:- 2-[1-(4-Aminophenyl)ethylidene]propanedinitrile
- Propanedinitrile, [1-(4-aminophenyl)ethylidene]-
- Propanedinitrile,[1-(4-aminophenyl)ethylidene]- (9CI)
- Propanedinitrile, 2-[1-(4-aminophenyl)ethylidene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.