CAS 1225208-49-0
:3,4-Bis[(4-methoxyphenyl)methoxy]-N-[2-(1-pyrrolidinyl)ethyl]benzamide
Description:
3,4-Bis[(4-methoxyphenyl)methoxy]-N-[2-(1-pyrrolidinyl)ethyl]benzamide, with the CAS number 1225208-49-0, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a benzamide core, which is modified by the presence of methoxy groups and a pyrrolidine moiety, contributing to its potential biological activity. The methoxyphenyl groups enhance lipophilicity, potentially influencing its solubility and permeability in biological systems. The pyrrolidinyl group may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's structure suggests it could interact with various biological targets, possibly exhibiting effects related to neurotransmission or receptor modulation. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many synthetic compounds, understanding its safety profile, stability, and reactivity is crucial for potential applications in pharmaceuticals or research.
Formula:C29H34N2O5
InChI:InChI=1S/C29H34N2O5/c1-33-25-10-5-22(6-11-25)20-35-27-14-9-24(29(32)30-15-18-31-16-3-4-17-31)19-28(27)36-21-23-7-12-26(34-2)13-8-23/h5-14,19H,3-4,15-18,20-21H2,1-2H3,(H,30,32)
InChI key:InChIKey=RTGZCRJKOPNHHH-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(OC)C=C1)C2=C(OCC3=CC=C(OC)C=C3)C=CC(C(NCCN4CCCC4)=O)=C2
Synonyms:- 3,4-Bis[(4-methoxyphenyl)methoxy]-N-[2-(1-pyrrolidinyl)ethyl]benzamide
- Benzamide, 3,4-bis[(4-methoxyphenyl)methoxy]-N-[2-(1-pyrrolidinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.