CymitQuimica logo

CAS 1225218-29-0

:

2-Methyl-5-(3-pyrrolidinyl)pyridine

Description:
2-Methyl-5-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a methyl group at the second position and a pyrrolidine substituent at the fifth position contributes to its unique properties. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen in its ring structure. It may exhibit basic properties due to the nitrogen atoms, which can participate in protonation reactions. The pyrrolidine moiety can influence the compound's solubility and reactivity, potentially enhancing its interaction with biological targets. Such compounds are often studied for their pharmacological potential, including effects on neurotransmitter systems. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. Overall, 2-Methyl-5-(3-pyrrolidinyl)pyridine represents a class of compounds with potential applications in medicinal chemistry and drug development.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-8-2-3-9(7-12-8)10-4-5-11-6-10/h2-3,7,10-11H,4-6H2,1H3
InChI key:InChIKey=RNWIAHGPFLARLR-UHFFFAOYSA-N
SMILES:CC=1C=CC(=CN1)C2CCNC2
Synonyms:
  • Pyridine, 2-methyl-5-(3-pyrrolidinyl)-
  • 2-Methyl-5-(3-pyrrolidinyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.