
CAS 1225218-55-2
:2-Cyclopropyl-5-(3-pyrrolidinyl)-1,3,4-oxadiazole
Description:
2-Cyclopropyl-5-(3-pyrrolidinyl)-1,3,4-oxadiazole is a chemical compound characterized by its unique oxadiazole ring structure, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The presence of a cyclopropyl group contributes to its rigidity and may influence its reactivity and interaction with biological targets. The pyrrolidine moiety introduces a nitrogen-containing heterocycle, which can enhance solubility and biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including effects on the central nervous system or as a scaffold for drug development. Its specific interactions and mechanisms of action would depend on its molecular conformation and the functional groups present. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c1-2-6(1)8-11-12-9(13-8)7-3-4-10-5-7/h6-7,10H,1-5H2
InChI key:InChIKey=CZYRHCJXUASSEX-UHFFFAOYSA-N
SMILES:C=1(OC(=NN1)C2CCNC2)C3CC3
Synonyms:- 2-Cyclopropyl-5-(3-pyrrolidinyl)-1,3,4-oxadiazole
- 1,3,4-Oxadiazole, 2-cyclopropyl-5-(3-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.