
CAS 1225218-56-3
:2-(2-Methylpropyl)-5-(3-pyrrolidinyl)-1,3,4-oxadiazole
Description:
2-(2-Methylpropyl)-5-(3-pyrrolidinyl)-1,3,4-oxadiazole is a chemical compound characterized by its unique oxadiazole ring structure, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. This compound features a branched alkyl group (2-methylpropyl) and a pyrrolidine moiety, contributing to its potential biological activity. The presence of the oxadiazole ring often imparts interesting pharmacological properties, making such compounds of interest in medicinal chemistry. Typically, oxadiazoles are known for their diverse applications, including use as pharmaceuticals, agrochemicals, and in materials science. The compound's molecular structure suggests it may exhibit lipophilicity due to the alkyl group, which can influence its solubility and permeability in biological systems. Additionally, the pyrrolidine ring may enhance interactions with biological targets, potentially leading to various therapeutic effects. Overall, 2-(2-Methylpropyl)-5-(3-pyrrolidinyl)-1,3,4-oxadiazole represents a class of compounds that could be explored for their utility in drug development and other applications.
Formula:C10H17N3O
InChI:InChI=1S/C10H17N3O/c1-7(2)5-9-12-13-10(14-9)8-3-4-11-6-8/h7-8,11H,3-6H2,1-2H3
InChI key:InChIKey=AUGKMFXIYJZRME-UHFFFAOYSA-N
SMILES:C(C(C)C)C=1OC(=NN1)C2CCNC2
Synonyms:- 2-Isobutyl-5-(pyrrolidin-3-yl)-1,3,4-oxadiazole
- 1,3,4-Oxadiazole, 2-(2-methylpropyl)-5-(3-pyrrolidinyl)-
- 2-(2-Methylpropyl)-5-(3-pyrrolidinyl)-1,3,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.