CymitQuimica logo

CAS 1225218-82-5

:

3-(3-Pyrrolidinyl)-1H-pyrazole

Description:
3-(3-Pyrrolidinyl)-1H-pyrazole, identified by its CAS number 1225218-82-5, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a pyrrolidine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its nitrogen-containing rings. The presence of the pyrrolidine moiety may contribute to its ability to interact with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Its specific applications and reactivity can vary based on the functional groups present and the conditions under which it is used. Overall, 3-(3-Pyrrolidinyl)-1H-pyrazole represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-3-8-5-6(1)7-2-4-9-10-7/h2,4,6,8H,1,3,5H2,(H,9,10)
InChI key:InChIKey=NQUKCXGPCOPNRA-UHFFFAOYSA-N
SMILES:C1(CCNC1)C=2C=CNN2
Synonyms:
  • 1H-Pyrazole, 3-(3-pyrrolidinyl)-
  • 3-(1H-Pyrazol-3-yl)pyrrolidine
  • 3-(3-Pyrrolidinyl)-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.