CAS 1225218-97-2
:Phenylmethyl 3-(3-pyridinyl)-1-pyrrolidinecarboxylate
Description:
Phenylmethyl 3-(3-pyridinyl)-1-pyrrolidinecarboxylate, identified by its CAS number 1225218-97-2, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a white to off-white solid, soluble in organic solvents, and may have limited solubility in water due to its hydrophobic characteristics. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the ester functional group in its structure may influence its reactivity and stability, as esters can undergo hydrolysis under certain conditions. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C17H18N2O2
InChI:InChI=1S/C17H18N2O2/c20-17(21-13-14-5-2-1-3-6-14)19-10-8-16(12-19)15-7-4-9-18-11-15/h1-7,9,11,16H,8,10,12-13H2
InChI key:InChIKey=URRADHFVXKQCTB-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(CC2)C=3C=CC=NC3
Synonyms:- 1-Pyrrolidinecarboxylic acid, 3-(3-pyridinyl)-, phenylmethyl ester
- Benzyl 3-(pyridin-3-yl)pyrrolidine-1-carboxylate
- Phenylmethyl 3-(3-pyridinyl)-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
