CymitQuimica logo

CAS 1225223-45-9

:

5-(2-Methyl-2-oxiranyl)pyrimidine

Description:
5-(2-Methyl-2-oxiranyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of the 2-methyl-2-oxiranyl group indicates that the compound has an epoxide functional group, contributing to its reactivity and potential applications in organic synthesis. This compound may exhibit properties typical of both pyrimidines and epoxides, such as being a potential building block in pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in nucleophilic reactions due to the strained epoxide ring, making it a candidate for further functionalization. Additionally, the presence of the methyl group may influence its solubility and stability. As with many organic compounds, its behavior in various chemical environments, including reactivity with nucleophiles or electrophiles, would be of interest in both synthetic and medicinal chemistry contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with its reactive functional groups.
Formula:C7H8N2O
InChI:InChI=1S/C7H8N2O/c1-7(4-10-7)6-2-8-5-9-3-6/h2-3,5H,4H2,1H3
InChI key:InChIKey=ZEKXVORFPYZXNQ-UHFFFAOYSA-N
SMILES:CC1(CO1)C=2C=NC=NC2
Synonyms:
  • 5-(2-Methyl-2-oxiranyl)pyrimidine
  • Pyrimidine, 5-(2-methyl-2-oxiranyl)-
  • 5-(2-Methyloxiran-2-yl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.