
CAS 1225227-39-3
:N-(4-Cyclopropyl-2-thiazolyl)-4-piperidinecarboxamide
Description:
N-(4-Cyclopropyl-2-thiazolyl)-4-piperidinecarboxamide, identified by its CAS number 1225227-39-3, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a thiazole moiety, which is a five-membered ring containing both sulfur and nitrogen. The cyclopropyl group attached to the thiazole contributes to its rigidity and may influence its biological activity. This compound is typically studied for its potential pharmacological properties, particularly in the context of drug development, where modifications to the piperidine and thiazole components can affect binding affinity and selectivity for biological targets. Its solubility, stability, and reactivity are influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Overall, the characteristics of this compound suggest it may have applications in therapeutic areas, although specific biological activities would require further investigation through experimental studies.
Formula:C12H17N3OS
InChI:InChI=1S/C12H17N3OS/c16-11(9-3-5-13-6-4-9)15-12-14-10(7-17-12)8-1-2-8/h7-9,13H,1-6H2,(H,14,15,16)
InChI key:InChIKey=JLLZMVKVFXEUKP-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCNCC1)C2=NC(=CS2)C3CC3
Synonyms:- N-(4-Cyclopropyl-2-thiazolyl)-4-piperidinecarboxamide
- 4-Piperidinecarboxamide, N-(4-cyclopropyl-2-thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.