
CAS 1225227-52-0
:2-[(1-Ethyl-4-piperidinyl)oxy]acetic acid
Description:
2-[(1-Ethyl-4-piperidinyl)oxy]acetic acid, with the CAS number 1225227-52-0, is a chemical compound characterized by its unique structure that includes a piperidine ring and an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. The ether linkage (the -O- group connecting the piperidine to the acetic acid) may also impart specific chemical stability and influence the compound's overall polarity. In terms of applications, compounds of this nature may be explored for their potential therapeutic effects, particularly in the fields of neurology or psychiatry, given the piperidine's role in modulating neurotransmitter systems. However, detailed studies would be necessary to fully elucidate its pharmacological properties and safety profile.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-2-10-5-3-8(4-6-10)13-7-9(11)12/h8H,2-7H2,1H3,(H,11,12)
InChI key:InChIKey=AYKMXYFUZXKYNM-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1CCN(CC)CC1
Synonyms:- 2-[(1-Ethyl-4-piperidinyl)oxy]acetic acid
- Acetic acid, 2-[(1-ethyl-4-piperidinyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.