CAS 1225228-43-2
:B-(6-Amino-2-fluoro-3-pyridinyl)boronic acid
Description:
B-(6-Amino-2-fluoro-3-pyridinyl)boronic acid, identified by its CAS number 1225228-43-2, is a boronic acid derivative characterized by the presence of a pyridine ring substituted with an amino group and a fluorine atom. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The amino group contributes to its potential as a ligand in coordination chemistry, while the fluorine atom can enhance its biological activity and lipophilicity. B-(6-Amino-2-fluoro-3-pyridinyl)boronic acid may also play a role in the development of pharmaceuticals, particularly in the context of targeted therapies, due to its ability to interact with specific biological targets. Its solubility and stability in various solvents can vary, influencing its reactivity and application in chemical reactions. Overall, this compound represents a valuable tool in both research and industrial applications, particularly in the fields of drug discovery and development.
Formula:C5H6BFN2O2
InChI:InChI=1S/C5H6BFN2O2/c7-5-3(6(10)11)1-2-4(8)9-5/h1-2,10-11H,(H2,8,9)
InChI key:InChIKey=QSFVGIFFWLUMOF-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(F)N=C(N)C=C1
Synonyms:- B-(6-Amino-2-fluoro-3-pyridinyl)boronic acid
- Boronic acid, B-(6-amino-2-fluoro-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
