CAS 1225228-87-4
:B-[6-(2-Methylpropoxy)-2-pyrazinyl]boronic acid
Description:
B-[6-(2-Methylpropoxy)-2-pyrazinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The compound features a pyrazine ring, which contributes to its aromatic properties and potential biological activity. The presence of the 2-methylpropoxy substituent enhances its solubility and may influence its reactivity and interaction with biological targets. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, this compound may exhibit properties relevant to drug development, particularly in the context of targeting specific enzymes or receptors. Its structural characteristics suggest potential applications in the fields of pharmaceuticals and agrochemicals, where boron-containing compounds are increasingly recognized for their versatility and effectiveness.
Formula:C8H13BN2O3
InChI:InChI=1S/C8H13BN2O3/c1-6(2)5-14-8-4-10-3-7(11-8)9(12)13/h3-4,6,12-13H,5H2,1-2H3
InChI key:InChIKey=MVIJGYUJEYHTQR-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=NC(B(O)O)=CN=C1
Synonyms:- [6-(2-Methylpropoxy)pyrazin-2-yl]boronic acid
- Boronic acid, B-[6-(2-methylpropoxy)-2-pyrazinyl]-
- B-[6-(2-Methylpropoxy)-2-pyrazinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
