CAS 1225228-89-6
:1-Ethyl 2-methyl-2-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)propanedioate
Description:
1-Ethyl 2-methyl-2-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)propanedioate, identified by its CAS number 1225228-89-6, is a chemical compound characterized by its complex structure, which includes a propanedioate moiety and a naphthalene derivative. This compound features an ethyl group and a methyl group attached to a central carbon, contributing to its unique properties. The presence of the tetrahydro-naphthalene ring system, along with a methoxy substituent, suggests potential for interesting interactions and reactivity, particularly in organic synthesis and medicinal chemistry. The compound may exhibit moderate to high lipophilicity due to its hydrophobic naphthalene structure, which could influence its solubility and bioavailability in biological systems. Additionally, the presence of multiple functional groups may allow for various chemical transformations, making it a candidate for further research in drug development or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for comprehensive characterization.
Formula:C17H22O5
InChI:InChI=1S/C17H22O5/c1-4-22-16(20)17(2,15(18)19)13-7-5-12-10-14(21-3)8-6-11(12)9-13/h6,8,10,13H,4-5,7,9H2,1-3H3,(H,18,19)
InChI key:InChIKey=NYKDPNQDSCCMMR-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(O)=O)(C)C1CC=2C(CC1)=CC(OC)=CC2
Synonyms:- 3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoic acid
- 3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoicacid
- Propanedioic acid, 2-methyl-2-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)-, 1-ethyl ester
- 1-Ethyl 2-methyl-2-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoic acid
CAS:Formula:C17H22O5Molecular weight:306.3536
