CymitQuimica logo

CAS 1225228-92-1

:

4-Methyl-4-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)-2-oxazolidinone

Description:
4-Methyl-4-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen. This compound includes a methyl group and a naphthalene derivative, contributing to its unique properties. The presence of the tetrahydro and methoxy groups indicates that it has a complex cyclic structure, which may influence its reactivity and interactions with biological systems. Typically, compounds of this nature can exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. The oxazolidinone moiety is often associated with antibacterial properties, although the specific biological activity of this compound would require further investigation. Its molecular structure suggests potential for various applications, including in drug development or as a synthetic intermediate. As with any chemical substance, safety data and handling precautions should be considered, particularly regarding its stability, solubility, and potential toxicity.
Formula:C15H19NO3
InChI:InChI=1S/C15H19NO3/c1-15(9-19-14(17)16-15)12-5-3-11-8-13(18-2)6-4-10(11)7-12/h4,6,8,12H,3,5,7,9H2,1-2H3,(H,16,17)
InChI key:InChIKey=FFEKNXZGYYAJGB-UHFFFAOYSA-N
SMILES:CC1(C2CC=3C(CC2)=CC(OC)=CC3)NC(=O)OC1
Synonyms:
  • 2-Oxazolidinone, 4-methyl-4-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)-
  • 4-Methyl-4-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)-2-oxazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.