CAS 1225232-42-7
:1,1-Dimethylethyl 5-chloro-2-[[3-methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methylene]pentanoate
Description:
1,1-Dimethylethyl 5-chloro-2-[[3-methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methylene]pentanoate, identified by its CAS number 1225232-42-7, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a methoxy group, and an imidazole moiety. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the imidazole ring suggests potential biological activity, possibly as a pharmaceutical agent or a bioactive compound. Its molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and ester hydrolysis. Additionally, the presence of multiple functional groups may contribute to its reactivity and interactions with biological systems. As with many synthetic compounds, safety data, including toxicity and environmental impact, would need to be evaluated to understand its handling and application in research or industry.
Formula:C21H27ClN2O3
InChI:InChI=1S/C21H27ClN2O3/c1-15-13-24(14-23-15)18-9-8-16(12-19(18)26-5)11-17(7-6-10-22)20(25)27-21(2,3)4/h8-9,11-14H,6-7,10H2,1-5H3
InChI key:InChIKey=JNFDBCRFDCPLDW-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C=C(C(OC(C)(C)C)=O)CCCCl)=C1)N2C=C(C)N=C2
Synonyms:- Pentanoic acid, 5-chloro-2-[[3-methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methylene]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 5-chloro-2-[[3-methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl]methylene]pentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.