CAS 122531-09-3
:5-Bromo-6-chloro-1H-indole
Description:
5-Bromo-6-chloro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and chlorine substituents at the 5 and 6 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as fluorescence and can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-rich nature of the indole ring. Additionally, its halogen substituents can influence its solubility and stability in different solvents. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose health risks. Overall, 5-Bromo-6-chloro-1H-indole is a significant compound in research and development within the field of organic chemistry.
Formula:C8H5BrClN
InChI:InChI=1S/C8H5BrClN/c9-6-3-5-1-2-11-8(5)4-7(6)10/h1-4,11H
SMILES:c1c[nH]c2cc(c(cc12)Br)Cl
Synonyms:- 5-Bromo-6-chloro-indole
- 5-Bromo-6-Chloroindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole, 5-bromo-6-chloro-
CAS:Formula:C8H5BrClNPurity:95%Color and Shape:SolidMolecular weight:230.4890Ref: IN-DA0017E2
1g34.00€5g71.00€10g109.00€1kgTo inquire25g190.00€100g504.00€500gTo inquire100mg22.00€250mg25.00€5-Bromo-6-chloro-1H-indole
CAS:Formula:C8H5BrClNPurity:95%Color and Shape:SolidMolecular weight:230.495-Bromo-6-chloro-1H-indole
CAS:5-Bromo-6-chloro-1H-indole is a fine chemical that is used as a building block for research chemicals, reagents, and speciality chemicals. It is soluble in chloroform and benzene, but insoluble in water. This product can be used as a reaction component or a useful intermediate in the production of complex compounds. 5-Bromo-6-chloro-1H-indole has been reported to be an effective scaffold for the synthesis of many novel compounds with potential applications such as pharmaceuticals, agrochemicals, and dyes.
Formula:C8H5BrClNPurity:Min. 95%Color and Shape:PowderMolecular weight:230.49 g/mol



