CAS 1225347-11-4
:2,2-Dimethyl-5-nitro-5-[6-(phenylmethoxy)-2-naphthalenyl]-1,3-dioxane
Description:
2,2-Dimethyl-5-nitro-5-[6-(phenylmethoxy)-2-naphthalenyl]-1,3-dioxane is a complex organic compound characterized by its unique structural features, including a dioxane ring, nitro group, and phenylmethoxy substituent. The presence of the nitro group typically imparts polar characteristics, influencing the compound's solubility and reactivity. The dioxane moiety contributes to the compound's stability and potential for forming hydrogen bonds, while the naphthalene derivative enhances its aromatic properties, which can affect its electronic behavior and interactions with other molecules. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could range from pharmaceuticals to materials science, depending on its specific properties and reactivity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the nitro group and other functional groups present.
Formula:C23H23NO5
InChI:InChI=1S/C23H23NO5/c1-22(2)28-15-23(16-29-22,24(25)26)20-10-8-19-13-21(11-9-18(19)12-20)27-14-17-6-4-3-5-7-17/h3-13H,14-16H2,1-2H3
InChI key:InChIKey=VSJBREXGTRXFPS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1(COC(C)(C)OC1)C2=CC3=C(C=C2)C=C(OCC4=CC=CC=C4)C=C3
Synonyms:- 2,2-Dimethyl-5-nitro-5-[6-(phenylmethoxy)-2-naphthalenyl]-1,3-dioxane
- 1,3-Dioxane, 2,2-dimethyl-5-nitro-5-[6-(phenylmethoxy)-2-naphthalenyl]-
- 5-(6-(Benzyloxy)naphthalen-2-yl)-2,2-dimethyl-5-nitro-1,3-dioxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(6-(Benzyloxy)naphthalen-2-yl)-2,2-dimethyl-5-nitro-1,3-dioxane
CAS:Formula:C23H23NO5Molecular weight:393.4324
