CymitQuimica logo

CAS 1225451-84-2

:

SKLB1002

Description:
As of my last update in October 2023, specific information about the chemical substance SKLB1002, with the CAS number 1225451-84-2, is limited in publicly available databases. Generally, substances with unique identifiers like CAS numbers are often associated with specific research compounds, pharmaceuticals, or industrial chemicals. Characteristics such as molecular structure, physical properties (like boiling and melting points), solubility, and reactivity would typically be detailed in scientific literature or safety data sheets. For a comprehensive understanding, including potential applications and safety information, consulting specialized databases, peer-reviewed articles, or material safety data sheets (MSDS) is recommended. If SKLB1002 is a novel compound or under investigation, detailed characteristics may be found in recent scientific publications or patent filings. Always ensure to reference the most current and reliable sources for the most accurate information regarding chemical substances.
Formula:C13H12N4O2S2
InChI:InChI=1S/C13H12N4O2S2/c1-7-16-17-13(20-7)21-12-8-4-10(18-2)11(19-3)5-9(8)14-6-15-12/h4-6H,1-3H3
InChI key:RQVGFDBMONQTBC-UHFFFAOYSA-N
SMILES:CC1=NN=C(S1)SC2=NC=NC3=CC(=C(C=C32)OC)OC
Found 7 products.