CymitQuimica logo

CAS 122549-26-2

:

methyl (2E)-2-(4-fluorobenzylidene)-4-methyl-3-oxopentanoate

Description:
Methyl (2E)-2-(4-fluorobenzylidene)-4-methyl-3-oxopentanoate is an organic compound characterized by its complex structure, which includes a methyl ester functional group and a conjugated double bond. The presence of a 4-fluorobenzylidene moiety indicates that it has a fluorine substituent on the aromatic ring, which can influence its reactivity and physical properties. This compound typically exhibits moderate to high lipophilicity due to its hydrophobic aromatic and aliphatic components, making it soluble in organic solvents. Its ketone and ester functionalities suggest potential reactivity in nucleophilic addition reactions and condensation reactions. The compound may also display interesting biological activities, as many derivatives of similar structures are known for their pharmacological properties. Additionally, the geometric configuration (2E) indicates the specific arrangement of substituents around the double bond, which can affect its stereochemistry and, consequently, its interactions in biological systems. Overall, this compound is of interest in synthetic organic chemistry and potentially in medicinal chemistry.
Formula:C14H15FO3
InChI:InChI=1/C14H15FO3/c1-9(2)13(16)12(14(17)18-3)8-10-4-6-11(15)7-5-10/h4-9H,1-3H3/b12-8+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.