CAS 122551-89-7
:3-Chloro-4-(dichloromethyl)-2(5H)-furanone
Description:
3-Chloro-4-(dichloromethyl)-2(5H)-furanone, with the CAS number 122551-89-7, is a synthetic organic compound characterized by its furanone structure, which includes a furan ring and a carbonyl group. This compound features a chlorine atom and a dichloromethyl group, contributing to its reactivity and potential applications in various chemical processes. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of chlorine atoms enhances its electrophilic character, making it useful in organic synthesis, particularly in the development of agrochemicals and pharmaceuticals. Additionally, its unique structure may impart specific biological activities, which can be of interest in medicinal chemistry. However, due to the presence of halogens, it may also pose environmental and health risks, necessitating careful handling and disposal. Overall, 3-Chloro-4-(dichloromethyl)-2(5H)-furanone is a compound of interest in both industrial and research settings, warranting further investigation into its properties and applications.
Formula:C5H3Cl3O2
InChI:InChI=1S/C5H3Cl3O2/c6-3-2(4(7)8)1-10-5(3)9/h4H,1H2
InChI key:InChIKey=WNQKLIFDPFSPIZ-UHFFFAOYSA-N
SMILES:C(Cl)(Cl)C1=C(Cl)C(=O)OC1
Synonyms:- 2(5H)-Furanone, 3-chloro-4-(dichloromethyl)-
- 3-Chloro-4-(Dichloromethyl)-2-Furanone
- 3-Chloro-4-(dichloromethyl)-2,5-dihydrofuran-2-one
- 3-chloro-4-(dichloromethyl)furan-2(5H)-one
- 3-Chloro-4-(dichloromethyl)-2(5H)-furanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Chloro-4-(dichloromethyl)-2(5H)-furanone
CAS:Controlled ProductFormula:C5H3Cl3O2Color and Shape:NeatMolecular weight:201.435

