CAS 122551-95-5
:4-O-PIVALOYL-3-HYDROXY-L-PHENYLALANINE
Description:
4-O-Pivaloyl-3-hydroxy-L-phenylalanine, with the CAS number 122551-95-5, is a derivative of the amino acid phenylalanine, modified to include a pivaloyl group at the 4-position and a hydroxyl group at the 3-position of the aromatic ring. This compound typically exhibits characteristics common to amino acids, such as the ability to form hydrogen bonds due to the presence of hydroxyl and carboxyl functional groups. The pivaloyl group enhances lipophilicity, potentially influencing its solubility and permeability in biological systems. The presence of the phenyl group contributes to its aromatic properties, which can affect its interaction with other molecules. This compound may be of interest in pharmaceutical applications, particularly in the design of prodrugs or as intermediates in the synthesis of more complex molecules. Additionally, its structural features suggest potential for specific interactions in biological systems, making it a candidate for further research in medicinal chemistry and biochemistry.
Formula:C14H19NO5
InChI:InChI=1/C14H19NO5/c1-14(2,3)13(19)20-11-5-4-8(7-10(11)16)6-9(15)12(17)18/h4-5,7,9,16H,6,15H2,1-3H3,(H,17,18)/t9-/m0/s1
SMILES:CC(C)(C)C(=O)Oc1ccc(C[C@@H](C(=O)O)N)cc1O
Synonyms:- L-Tyrosine, 3-Hydroxy-, 4-(2,2-Dimethylpropanoate)
- L-3-(3-Hydroxy-4-Pivaloyloxyphenyl)Alanine
- 4-O-Pivaloyl-L-Dopa
- Pdopa
- 3-Hydroxy-L-Tyrosine4-(2,2-Dimethylpropanoate)
- Nb355
- 4-O-Pivaloyl-L-DOPA L-3-(3-Hydroxy-4-pivaloyloxyphenyl)alanine
- O-(2,2-dimethylpropanoyl)-3-hydroxy-L-tyrosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
