
CAS 1225521-02-7
:2-(2-Fluorophenyl)-1-methyl-1H-imidazole
Description:
2-(2-Fluorophenyl)-1-methyl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its reactivity. The methyl group attached to the imidazole ring contributes to its overall hydrophobic character. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug design. Additionally, the presence of fluorine can enhance metabolic stability and lipophilicity, affecting the compound's pharmacokinetics. As with many imidazole derivatives, it may also display properties such as antifungal or antibacterial activity, depending on the specific substituents and their arrangement. Safety and handling considerations should be taken into account, as with all chemical substances, particularly in laboratory settings.
Formula:C10H9FN2
InChI:InChI=1S/C10H9FN2/c1-13-7-6-12-10(13)8-4-2-3-5-9(8)11/h2-7H,1H3
InChI key:InChIKey=HSJOFKZWSQOEMA-UHFFFAOYSA-N
SMILES:CN1C(=NC=C1)C2=C(F)C=CC=C2
Synonyms:- 2-(2-Fluorophenyl)-1-methyl-1H-imidazole
- 1H-Imidazole, 2-(2-fluorophenyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.