CAS 1225539-41-2

1-(2-Methoxyphenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

Description:

1-(2-Methoxyphenyl)-5-methyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy group attached to a phenyl ring, contributing to its aromatic properties and potential for various interactions. The presence of a carboxylic acid functional group enhances its acidity and solubility in polar solvents, making it suitable for various chemical reactions and applications. The methyl group at the 5-position of the pyrazole ring can influence the compound's steric and electronic properties, potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1S/C12H12N2O3/c1-8-7-9(12(15)16)13-14(8)10-5-3-4-6-11(10)17-2/h3-7H,1-2H3,(H,15,16)

InChI key: InChIKey=QYSJRNJQUMVKBD-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C(O)=O)C1)C2=C(OC)C=CC=C2

Synonyms:

• 1-(2-Methoxyphenyl)-5-methyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-(2-methoxyphenyl)-5-methyl-

1-(2-Methoxyphenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

CAS: 1225539-41-2

Formula: C₁₂H₁₂N₂O₃

Molecular weight: 232.239

Ref: 10-F096148