CAS 122568-03-0
:3'-deoxy-4-thiothymidine
Description:
3'-Deoxy-4-thiothymidine, also known as TDT, is a nucleoside analog that features a sulfur atom in place of the oxygen atom at the 4-position of the thymidine base. This modification imparts unique properties to the compound, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The presence of the sulfur atom can enhance the stability of the molecule and alter its interaction with biological targets, such as DNA polymerases. 3'-Deoxy-4-thiothymidine is typically characterized by its ability to inhibit viral replication and its potential use in combination therapies. It is soluble in water and exhibits moderate lipophilicity, which can influence its bioavailability and cellular uptake. The compound's structure allows it to mimic natural nucleosides, facilitating its incorporation into nucleic acids during replication processes. Overall, 3'-deoxy-4-thiothymidine represents a significant area of study for developing new therapeutic agents against viral infections and certain types of cancer.
Formula:C10H14N2O3S
InChI:InChI=1/C10H14N2O3S/c1-6-4-12(10(14)11-9(6)16)8-3-2-7(5-13)15-8/h4,7-8,13H,2-3,5H2,1H3,(H,11,14,16)/t7-,8+/m0/s1
Synonyms:- 1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-5-methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one
- Ddthds
- Thymidine, 3'-deoxy-4-thio-
- 3'-Deoxy-4-thiothymidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3'-Deoxy-4-thiothymidine
CAS:3'-Deoxy-4-thiothymidine can moderately active in protecting HIV-induced cytopathogenicity of MT-2 and CEM cells.Formula:C10H14N2O3SColor and Shape:SolidMolecular weight:242.29
