CAS 122571-17-9

1,3-Bis(4-methoxyphenyl)-1,1,3,3-tetramethyldisiloxane, 97%

Description:

1,3-Bis(4-methoxyphenyl)-1,1,3,3-tetramethyldisiloxane is an organosilicon compound characterized by its unique siloxane backbone and aromatic substituents. This compound features two para-methoxyphenyl groups attached to a siloxane chain, which contributes to its stability and versatility in various applications. It is typically a colorless to pale yellow liquid with a relatively high boiling point, indicating significant thermal stability. The presence of methoxy groups enhances its solubility in organic solvents and may impart specific electronic properties, making it useful in materials science, particularly in the development of silicone-based polymers and coatings. Additionally, its siloxane structure provides flexibility and resistance to moisture, making it suitable for applications in sealants and adhesives. The compound is often utilized in research and industrial settings, and its purity is indicated by the "97%" designation, suggesting a high level of refinement suitable for various chemical applications. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₈H₂₆O₃Si₂

InChI: InChI=1/C18H26O3Si2/c1-19-15-7-11-17(12-8-15)22(3,4)21-23(5,6)18-13-9-16(20-2)10-14-18/h7-14H,1-6H3

SMILES: COc1ccc(cc1)[Si](C)(C)O[Si](C)(C)c1ccc(cc1)OC

Synonyms:

• (4-Methoxyphenyl)-[(4-Methoxyphenyl)-Dimethyl-Silyl]Oxy-Dimethyl-Silane

1,3-Bis(4-methoxyphenyl)-1,1,3,3-tetramethyldisiloxane

CAS: 122571-17-9

Formula: C₁₈H₂₆O₃Si₂

Purity: 97%

Molecular weight: 346.5682

Ref: IN-DA003DHP

(4-Methoxyphenyl)({[(4-methoxyphenyl)dimethylsilyl]oxy})dimethylsilane

CAS: 122571-17-9

(4-Methoxyphenyl)({[(4-methoxyphenyl)dimethylsilyl]oxy})dimethylsilane

Purity: ≥95%

Molecular weight: 346.57g/mol

Ref: 54-OR303374