
CAS 1225727-11-6
:1-(4-Ethylphenyl)-2-piperidinone
Description:
1-(4-Ethylphenyl)-2-piperidinone, identified by its CAS number 1225727-11-6, is an organic compound characterized by a piperidinone structure substituted with an ethylphenyl group. This compound features a piperidine ring, which is a six-membered ring containing one nitrogen atom, and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethylphenyl substituent enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. Typically, compounds of this nature are studied for their potential pharmacological properties, including analgesic or psychoactive effects. The molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis and characterization are important for understanding its properties and potential applications in drug development or as a chemical intermediate. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c1-2-11-6-8-12(9-7-11)14-10-4-3-5-13(14)15/h6-9H,2-5,10H2,1H3
InChI key:InChIKey=BYHMXOFBHPZECA-UHFFFAOYSA-N
SMILES:O=C1N(CCCC1)C2=CC=C(CC)C=C2
Synonyms:- 1-(4-Ethylphenyl)-2-piperidinone
- 2-Piperidinone, 1-(4-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.