CAS 122584-18-3

N-[(2-Bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]formamide

Description:

N-[(2-Bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]formamide, with the CAS number 122584-18-3, is a chemical compound characterized by its complex structure, which includes a formamide functional group and multiple aromatic rings. The presence of bromine and hydroxy groups suggests potential for hydrogen bonding and reactivity, while the methoxy group may influence its solubility and electronic properties. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can affect its biological activity and interactions with other molecules. The specific arrangement of substituents on the phenyl rings can lead to unique pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance may have applications in pharmaceutical research, particularly in the development of therapeutic agents targeting specific biological pathways.

Formula: C₁₇H₁₈BrNO₄

InChI: InChI=1S/C17H18BrNO4/c1-23-17-9-15(18)13(8-16(17)22)10-19(11-20)7-6-12-2-4-14(21)5-3-12/h2-5,8-9,11,21-22H,6-7,10H2,1H3

InChI key: InChIKey=WZPIJXQLACAELC-UHFFFAOYSA-N

SMILES: C(N(CCC1=CC=C(O)C=C1)C=O)C2=C(Br)C=C(OC)C(O)=C2

Synonyms:

• Formamide, N-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-
• N-(2-Bromo-5-hydroxy-4-methoxy-benzyl)-N-[2-(4-hydroxy-phenyl)-ethyl]formamide
• N-[(2-Bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]formamide

Formamide, N-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]-N-[2-(4-hydroxyphenyl)ethyl]-

CAS: 122584-18-3

Formula: C₁₇H₁₈BrNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 380.2331

Ref: IN-DA0017HJ

N-(p-Hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide

Controlled Product

CAS: 122584-18-3

N-(p-Hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide is an anticancer drug that belongs to the class of phenethyl derivatives. It is a radiosensitizer that inhibits DNA and RNA synthesis, leading to cancer cell death. The drug has been shown to have a chiral center and two enantiomers, with the (S)-enantiomer being more active than the (R)-enantiomer. N-(p-Hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4-methoxybenzyl)formamide has been shown to be effective in animal models for brain tumors and breast cancer cells. It has also been shown to be effective against leukemia cells, which are resistant to other treatments. N-(p-Hydroxyphenethyl)-N-(2-bromo-5-hydroxy-4

Formula: C₁₇H₁₈BrNO₄

Purity: Min. 95%

Molecular weight: 380.23 g/mol

Ref: 3D-FH24448