
CAS 1225846-52-5
:3-Chloro-2-methoxy-α-methylbenzenemethanol
Description:
3-Chloro-2-methoxy-α-methylbenzenemethanol is an organic compound characterized by its complex structure, which includes a chlorinated aromatic ring, a methoxy group, and a hydroxymethyl substituent. The presence of the chlorine atom introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The methoxy group contributes to the compound's overall hydrophobic character while also providing potential sites for hydrogen bonding. The α-methyl group enhances steric hindrance, which may affect the compound's interactions with biological targets or other chemical species. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its molecular weight, boiling point, and other physical properties would depend on the specific arrangement of atoms and the presence of functional groups, which can significantly influence its behavior in chemical reactions and applications. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C9H11ClO2
InChI:InChI=1S/C9H11ClO2/c1-6(11)7-4-3-5-8(10)9(7)12-2/h3-6,11H,1-2H3
InChI key:InChIKey=HNPBTNGCSBNXED-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C)O)C=CC=C1Cl
Synonyms:- Benzenemethanol, 3-chloro-2-methoxy-α-methyl-
- 3-Chloro-2-methoxy-α-methylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.