CAS 122590-03-8
:(3'Z)-3'-ethylidene-6-hydroxy-1-methoxy-1',2',3',4',4a',5',9',9a'-octahydro-7'H-spiro[indole-3,8'-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one
Description:
The chemical substance known as (3'Z)-3'-ethylidene-6-hydroxy-1-methoxy-1',2',3',4',4a',5',9',9a'-octahydro-7'H-spiro[indole-3,8'-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, with the CAS number 122590-03-8, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indole and pyridine moieties. This compound features multiple functional groups, including a hydroxy group and a methoxy group, contributing to its potential reactivity and biological activity. The presence of the ethylidene group suggests that it may exhibit specific stereochemical properties, influencing its interactions in biological systems. The intricate arrangement of rings and substituents indicates that this substance may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural complexity and potential for diverse interactions highlight the importance of studying such compounds for their therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C20H24N2O4
InChI:InChI=1/C20H24N2O4/c1-3-11-9-21-16-8-20(18-7-13(11)14(16)10-26-18)15-5-4-12(23)6-17(15)22(25-2)19(20)24/h3-6,13-14,16,18,21,23H,7-10H2,1-2H3/b11-3+
Synonyms:- Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-6-hydroxy-1-methoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-
- Nb-Demethyl-11-hydroxyhumantenine
- 11-Hydroxyrankinidine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-6-hydroxy-1-methoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-
CAS:Formula:C20H24N2O4Purity:96.0%Molecular weight:356.415611-Hydroxyrankinidine
CAS:<p>11-Hydroxyrankinidine is a natural product for research related to life sciences. The catalog number is TN2586 and the CAS number is 122590-03-8.</p>Formula:C20H24N2O4Purity:98%Color and Shape:SolidMolecular weight:356.4211-Hydroxyrankinidine
CAS:Formula:C20H24N2O4Purity:95%~99%Color and Shape:PowderMolecular weight:356.42211-Hydroxyrankinidine
CAS:<p>11-Hydroxyrankinidine is an alkaloid derivative, which is sourced from the plant Alstonia scholaris, commonly known in traditional medicine for its array of bioactive compounds. It functions through modulation of cellular pathways involved in cancer cell proliferation and apoptosis. The compound has shown the capability to interfere with specific signaling cascades, altering the cellular environment to reduce cancer cell viability.</p>Formula:C20H24N2O4Purity:Min. 95%Molecular weight:356.4 g/mol




