CymitQuimica logo

CAS 122590-75-4

:

methyl 4-azido-2,3,5,6-tetrafluorobenzoate

Description:
Methyl 4-azido-2,3,5,6-tetrafluorobenzoate is a chemical compound characterized by its azido functional group and multiple fluorine substituents on a benzoate structure. The presence of the azido group (-N3) indicates potential reactivity, particularly in click chemistry and other synthetic applications. The tetrafluorobenzoate moiety suggests that the compound has significant electron-withdrawing characteristics due to the fluorine atoms, which can influence its reactivity and stability. This compound is likely to be a solid at room temperature and may exhibit unique physical properties such as high thermal stability and low solubility in non-polar solvents. Its fluorinated nature may also impart hydrophobic characteristics, making it useful in various applications, including materials science and medicinal chemistry. Safety precautions should be taken when handling this compound, as azides can be sensitive to heat and shock, potentially leading to explosive decomposition. Overall, methyl 4-azido-2,3,5,6-tetrafluorobenzoate is a specialized compound with applications in advanced chemical synthesis and research.
Formula:C8H3F4N3O2
InChI:InChI=1/C8H3F4N3O2/c1-17-8(16)2-3(9)5(11)7(14-15-13)6(12)4(2)10/h1H3
SMILES:COC(=O)c1c(c(c(c(c1F)F)N=[N+]=[NH-])F)F
Synonyms:
  • 4-Azido-2,3,5,6-tetrafluorobenzoic acid methyl ester
  • ATFMB methyl ester
  • Methyl 4-azido-2,3,5,6-tetrafluorobenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.