CAS 122590-77-6
:4-AZIDO-2,3,5,6-TETRAFLUOROBENZOIC ACID
Description:
4-Azido-2,3,5,6-tetrafluorobenzoic acid is a specialized chemical compound characterized by the presence of an azido group (-N3) and multiple fluorine substituents on a benzoic acid framework. The presence of four fluorine atoms significantly influences its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated analogs. The azido group introduces unique reactivity, making it a potential candidate for various applications in organic synthesis and materials science. This compound is typically used in research settings, particularly in the development of fluorinated materials or as an intermediate in the synthesis of more complex molecules. Its structure suggests that it may exhibit interesting thermal and photochemical properties, which could be exploited in specific applications. Additionally, the presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions. Safety precautions should be taken when handling this compound due to the potential hazards associated with azido compounds, which can be sensitive and reactive under certain conditions.
Formula:C7HF4N3O2
InChI:InChI=1/C7HF4N3O2/c8-2-1(7(15)16)3(9)5(11)6(4(2)10)13-14-12/h(H,15,16)
SMILES:c1(c(c(c(c(c1F)F)N=[N+]=[NH-])F)F)C(=O)O
Synonyms:- Atfb
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Azido-2,3,5,6-tetrafluorobenzoic Acid
CAS:Formula:C7HF4N3O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystallineMolecular weight:235.10Benzoic acid, 4-azido-2,3,5,6-tetrafluoro-
CAS:Formula:C7HF4N3O2Purity:98%Color and Shape:SolidMolecular weight:235.09544-Azido-2,3,5,6-Tetrafluorobenzoic Acid
CAS:4-Azido-2,3,5,6-Tetrafluorobenzoic AcidPurity:98%Molecular weight:235.1g/mol4-Azido-2,3,5,6-tetrafluorobenzoic Acid(>90%)
CAS:Controlled ProductFormula:C7HF4N3O2Purity:>90%Color and Shape:NeatMolecular weight:235.14-Azido-2,3,5,6-tetrafluorobenzoic acid
CAS:Formula:C7HF4N3O2Purity:95%Color and Shape:SolidMolecular weight:235.0984-Azido-2,3,5,6-tetrafluorobenzoic Acid
CAS:4-Azido-2,3,5,6-tetrafluorobenzoic Acid (N3-TFBA) serves both as a click chemistry reagent with an azide group and as a complex with FAM-labeled DNA probe. This compound is also employed as a versatile photoaffinity labeling agent for probing biological receptors.Formula:C7HF4N3O2Color and Shape:SolidMolecular weight:235.1





