CAS 1226-26-2: 5-(Phenoxymethyl)-3-phenyl-1,3-oxazolidin-2-one
Description:5-(Phenoxymethyl)-3-phenyl-1,3-oxazolidin-2-one, with the CAS number 1226-26-2, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity. It is known for its role in medicinal chemistry, particularly as a scaffold for the development of antibacterial agents. The presence of the phenoxymethyl and phenyl groups contributes to its lipophilicity, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Additionally, the oxazolidinone moiety is significant in the context of drug design, as it can interact with various biological targets. The compound may also exhibit stability under standard laboratory conditions, although specific reactivity and solubility characteristics would depend on the solvent and environmental conditions. Overall, this compound represents a valuable structure in the exploration of therapeutic agents.
Formula:C16H15NO3
InChI:InChI=1S/C16H15NO3/c18-16-17(13-7-3-1-4-8-13)11-15(20-16)12-19-14-9-5-2-6-10-14/h1-10,15H,11-12H2
InChI key:InChIKey=TVCILYMEQCWTGP-UHFFFAOYSA-N
SMILES:O=C1OC(COC=2C=CC=CC2)CN1C=3C=CC=CC3
- Synonyms:
- 3-Phenyl-5-phenoxymethyl-2-oxazolidone
- 5-Phenoxymethyl-3-phenyloxazolidin-2-one
- 2-Oxazolidinone, 5-(phenoxymethyl)-3-phenyl-
- 3-Phenyl-5-phenoxymethyl-2-oxazolidinone
- 3-Phenyl-5-phenoxymethyl-2-oxazolidone
- 5-Phenoxymethyl-3-phenyl-2-oxazolidone
- 5-(Phenoxymethyl)-3-phenyl-1,3-oxazolidin-2-one
- 5-(Phenoxymethyl)-3-phenyl-2-oxazolidinone
- 5-Phenoxymethyl-3-phenyl-2-oxazolidone
- 2-oxazolidinone, 5-(phenoxymethyl)-3-phenyl-
- See more synonyms
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-phenyl-5-(phenoxymethyl)-1,3-oxazolidin-2-one REF: 3D-BAA22626CAS: 1226-26-2 | Min. 95% | 110.00 €~746.00 € | Tue 08 Apr 25 |
![]() | 5-(Phenoxymethyl)-3-phenyloxazolidin-2-one REF: 10-F734594CAS: 1226-26-2 | 98% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-phenyl-5-(phenoxymethyl)-1,3-oxazolidin-2-one
Ref: 3D-BAA22626
50mg | 483.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
5-(Phenoxymethyl)-3-phenyloxazolidin-2-one
Ref: 10-F734594
100mg | Discontinued | Request information |