CAS 12260-67-2: (1-Cycloenten-1YL)-Ferrocene

Description:(1-Cycloenten-1-yl)-ferrocene is an organometallic compound characterized by the presence of a ferrocene moiety, which consists of two cyclopentadienyl anions sandwiching a central iron atom. This compound features a cycloalkene substituent, specifically a cyclopentene group, attached to one of the cyclopentadienyl rings. The presence of the cycloalkene introduces unique reactivity and steric properties, making it of interest in various chemical applications, including catalysis and materials science. The compound exhibits stability typical of ferrocene derivatives, with a relatively high melting point and good solubility in organic solvents. Its electronic properties are influenced by the iron center, which can participate in redox reactions, allowing for potential applications in electrochemistry. Additionally, the structural characteristics of (1-Cycloenten-1-yl)-ferrocene can lead to interesting interactions in coordination chemistry and may serve as a precursor for further synthetic modifications. Overall, this compound exemplifies the versatility of ferrocene derivatives in organic and inorganic chemistry.

Formula:C₁₅H₁₆Fe

InChI:InChI=1/C10H11.C5H5.Fe/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1;/h1-2,5-7H,3-4,8H2;1-5H;/rC15H16Fe/c1-2-7-12(6-1)14-10-5-11-15(14)16-13-8-3-4-9-13/h3-6,8-11,13,15H,1-2,7H2

Synonyms:
Cyclopentenylferrocene

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Cyclopentenylferrocene REF: 3B-F0313CAS: 12260-67-2	>96.0%(T)	127.00 €	Wed 19 Mar 25
Ferrocene, (1-cyclopenten-1-yl)- REF: IN-DA0017IXCAS: 12260-67-2	96%	47.00 €~110.00 €	Wed 26 Mar 25
Cyclopentenylferrocene REF: 3D-MAA26067CAS: 12260-67-2	Min. 95%	- - -	Discontinued product