CAS 122616-98-2
:4-azido-2,3,5,6-tetrafluorobenzamide
Description:
4-Azido-2,3,5,6-tetrafluorobenzamide is a chemical compound characterized by the presence of an azido group (-N3) and multiple fluorine substituents on a benzamide structure. The compound features a benzene ring that is substituted at the 2, 3, 5, and 6 positions with fluorine atoms, which significantly influences its reactivity and physical properties. The azido group is known for its potential to undergo various chemical transformations, including click chemistry reactions, making this compound of interest in synthetic organic chemistry and materials science. The presence of fluorine atoms typically enhances the compound's stability and lipophilicity, while the azido group can introduce unique reactivity patterns. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms and the azido group. Overall, 4-azido-2,3,5,6-tetrafluorobenzamide is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and advanced materials.
Formula:C7H2F4N4O
InChI:InChI=1/C7H2F4N4O/c8-2-1(7(12)16)3(9)5(11)6(4(2)10)14-15-13/h(H2,12,16)
SMILES:c1(c(c(c(c(c1F)F)N=[N+]=[NH-])F)F)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Azido-2,3,5,6-tetrafluorobenzamide
CAS:Formula:C7H2F4N4OColor and Shape:SolidMolecular weight:234.11064-Azido-2,3,5,6-tetrafluorobenzamide
CAS:Controlled ProductApplications 4-Azido-2,3,5,6-tetrafluorobenzamide (cas# 122616-98-2) is a compound useful in organic synthesis.
Formula:C7H2F4N4OColor and Shape:NeatMolecular weight:234.11

