CymitQuimica logo

CAS 122623-81-8

:

Propanoic acid, 2-(3-chlorophenoxy)-, methyl ester

Description:
Propanoic acid, 2-(3-chlorophenoxy)-, methyl ester, also known by its CAS number 122623-81-8, is an organic compound characterized by its ester functional group, which is derived from propanoic acid and a chlorophenoxy moiety. This compound typically exhibits a moderate polarity due to the presence of both the ester and aromatic groups, influencing its solubility in various organic solvents. The chlorophenoxy group contributes to its potential biological activity, making it of interest in agricultural and pharmaceutical applications. The presence of the chlorine atom can enhance the compound's stability and reactivity, affecting its interaction with biological systems. In terms of physical properties, it may have a relatively low boiling point and moderate volatility, typical of esters. Additionally, it may exhibit specific reactivity patterns, such as undergoing hydrolysis in the presence of water or reacting with nucleophiles. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields.
Formula:C10H11ClO3
InChI:InChI=1S/C10H11ClO3/c1-7(10(12)13-2)14-9-5-3-4-8(11)6-9/h3-7H,1-2H3
InChI key:InChIKey=BTQPMYMMANTZGP-UHFFFAOYSA-N
SMILES:O(C(C(OC)=O)C)C1=CC(Cl)=CC=C1
Synonyms:
  • Propanoic acid, 2-(3-chlorophenoxy)-, methyl ester, (±)-
  • Methyl 2-(3-chlorophenoxy)propionate
  • Propanoic acid, 2-(3-chlorophenoxy)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.