CAS 122631-40-7

2-Methyl-3-[(1E)-2-nitroethenyl]-1H-indole

Description:

2-Methyl-3-[(1E)-2-nitroethenyl]-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 2-position and a nitroethenyl group at the 3-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties typical of indole derivatives, such as fluorescence and biological activity, making it of interest in pharmaceutical research. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and interaction with biological targets. Additionally, the compound's structure suggests potential for various substitution reactions, allowing for further derivatization. Its CAS number, 122631-40-7, facilitates its identification in chemical databases and literature. Overall, 2-Methyl-3-[(1E)-2-nitroethenyl]-1H-indole represents a versatile scaffold for exploring new chemical entities with potential therapeutic applications.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1S/C11H10N2O2/c1-8-9(6-7-13(14)15)10-4-2-3-5-11(10)12-8/h2-7,12H,1H3/b7-6+

InChI key: InChIKey=DTSVTKXSWKXFDC-VOTSOKGWSA-N

SMILES: C(=C/N(=O)=O)\C=1C=2C(NC1C)=CC=CC2

Synonyms:

• 2-Methyl-3-[(1E)-2-nitroethenyl]-1H-indole
• 1H-Indole, 2-methyl-3-(2-nitroethenyl)-, (E)-
• 1H-Indole, 2-methyl-3-[(1E)-2-nitroethenyl]-
• (E)-2-Methyl-3-(2-nitrovinyl)-1H-indole