CymitQuimica logo

CAS 122640-83-9

:

Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride

Description:
Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride, with the CAS number 122640-83-9, is a chemical compound characterized by its anhydride functional groups derived from tetracarboxylic acids. This substance typically appears as a solid and is known for its high thermal stability and excellent chemical resistance, making it suitable for various applications in polymer chemistry and materials science. It is often utilized as a curing agent or hardener in epoxy resins, enhancing the mechanical properties and thermal performance of the resulting materials. The presence of multiple carboxylic anhydride groups allows for cross-linking with polyfunctional amines or other reactive compounds, leading to the formation of robust networks. Additionally, its dicyclohexyl structure contributes to its rigidity and hydrophobic characteristics. Safety considerations should be taken into account when handling this compound, as it may cause irritation upon contact with skin or mucous membranes. Overall, dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride is a valuable material in advanced composite and adhesive formulations.
Formula:C16H18O6
InChI:InChI=1S/C16H18O6/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18/h7-12H,1-6H2
InChI key:SNHKMHUMILUWSJ-UHFFFAOYSA-N
SMILES:C1CC2C(CC1C3CCC4C(C3)C(=O)OC4=O)C(=O)OC2=O
Synonyms:
  • [5,5'-Biisobenzofuran]-1,1',3,3'-tetrone, dodecahydro-
  • Dodecahydro-5,5'-bi-2-benzofuran-1,1',3,3'-tetrone
  • Dicyclohexyl-3,4,3,4-tetracarboxylic dianhydride
Found 6 products.