CAS 1226507-41-0

1-Methyl-α-(trifluoromethyl)-1H-imidazole-5-methanol

Description:

1-Methyl-α-(trifluoromethyl)-1H-imidazole-5-methanol is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a methyl group at the 1-position and a trifluoromethyl group at the α-position contributes to its unique properties, including increased lipophilicity and potential biological activity. The hydroxymethyl group at the 5-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the design of pharmaceuticals that target specific biological pathways. Its trifluoromethyl group is known to enhance metabolic stability and bioactivity. As with many fluorinated compounds, it may exhibit distinct physicochemical properties, such as altered boiling and melting points, compared to its non-fluorinated analogs. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₇F₃N₂O

InChI: InChI=1S/C6H7F3N2O/c1-11-3-10-2-4(11)5(12)6(7,8)9/h2-3,5,12H,1H3

InChI key: InChIKey=VXSLBYIKDMXYEJ-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(O)C=1N(C)C=NC1

Synonyms:

• 2,2,2-Trifluoro-1-(1-methyl-1H-imidazol-5-yl)ethan-1-ol
• 1-Methyl-α-(trifluoromethyl)-1H-imidazole-5-methanol
• 1H-Imidazole-5-methanol, 1-methyl-α-(trifluoromethyl)-
• 2,2,2-Trifluoro-1-(1-methyl-1H-imidazol-5-yl)ethanol