CymitQuimica logo

CAS 122661-25-0

:

1-pyrazin-2-ylmethanamine dihydrochloride

Description:
1-Pyrazin-2-ylmethanamine dihydrochloride is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amine functional group, contributing to its basicity and potential reactivity. As a dihydrochloride salt, it is typically encountered in a hydrated form, enhancing its solubility in water, which is advantageous for various applications, particularly in pharmaceutical contexts. The presence of the pyrazine moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular structure allows for potential interactions with biological targets, and it may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further research. Additionally, handling this compound requires standard safety precautions due to its amine nature and potential for reactivity. Overall, 1-pyrazin-2-ylmethanamine dihydrochloride is a versatile compound with implications in both research and application in the field of chemistry and pharmacology.
Formula:C5H9Cl2N3
InChI:InChI=1/C5H7N3.2ClH/c6-3-5-4-7-1-2-8-5;;/h1-2,4H,3,6H2;2*1H
SMILES:c1cnc(CN)cn1.Cl.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.