CAS 122665-98-9

2-Methyl-4-(methylthio)butanoic acid

Description:

2-Methyl-4-(methylthio)butanoic acid, also known as methionine sulfoximine, is an organic compound characterized by its branched-chain structure and the presence of both a carboxylic acid group and a methylthio group. This compound is a derivative of methionine, an essential amino acid, and is notable for its role in various biochemical processes. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents like water and alcohols. The presence of the methylthio group contributes to its unique properties, including its potential as a flavor enhancer in food applications. Additionally, 2-Methyl-4-(methylthio)butanoic acid has been studied for its effects on plant growth and development, as well as its potential applications in agriculture. Its molecular structure allows for various interactions in biological systems, making it of interest in both nutritional and pharmaceutical research. Safety data indicates that, while it is generally regarded as safe in appropriate concentrations, handling should still follow standard laboratory safety protocols.

Formula: C₆H₁₂O₂S

InChI: InChI=1S/C6H12O2S/c1-5(6(7)8)3-4-9-2/h5H,3-4H2,1-2H3,(H,7,8)

InChI key: InChIKey=QSCMVGTXPXZIOH-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CCSC)C

Synonyms:

• Butanoic acid, 2-methyl-4-(methylthio)-
• 2-Methyl-4-(methylthio)butanoic acid
• 2-Methyl-4-(methylsulfanyl)butanoic acid