CymitQuimica logo

CAS 1226776-84-6

:

2-Methyl 4-(phenylmethyl) tetrahydro-1,4-oxazepine-2,4(5H)-dicarboxylate

Description:
2-Methyl 4-(phenylmethyl) tetrahydro-1,4-oxazepine-2,4(5H)-dicarboxylate is a chemical compound characterized by its unique oxazepine ring structure, which incorporates both nitrogen and oxygen atoms in a seven-membered cyclic framework. This compound features a methyl group and a phenylmethyl substituent, contributing to its complexity and potential for diverse chemical interactions. The presence of two carboxylate ester groups enhances its reactivity and solubility in various organic solvents. The oxazepine moiety is known for its potential biological activity, making this compound of interest in medicinal chemistry. Its structural features may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the stereochemistry of the compound can play a significant role in its biological interactions and efficacy. Overall, 2-Methyl 4-(phenylmethyl) tetrahydro-1,4-oxazepine-2,4(5H)-dicarboxylate represents a class of compounds that may exhibit interesting chemical and biological properties, warranting further investigation for potential applications in drug development or other fields.
Formula:C15H19NO5
InChI:InChI=1S/C15H19NO5/c1-19-14(17)13-10-16(8-5-9-20-13)15(18)21-11-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3
InChI key:InChIKey=FPWQZFRFYFDZAN-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(C(OC)=O)OCCC2
Synonyms:
  • 2-Methyl 4-(phenylmethyl) tetrahydro-1,4-oxazepine-2,4(5H)-dicarboxylate
  • 1,4-Oxazepine-2,4(5H)-dicarboxylic acid, tetrahydro-, 2-methyl 4-(phenylmethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.