
CAS 1226776-85-7
:Carbamic acid, N-[4-(aminomethyl)-2-pyridinyl]-, 1,1-dimethylethyl ester, hydrochloride (1:2)
Description:
Carbamic acid, N-[4-(aminomethyl)-2-pyridinyl]-, 1,1-dimethylethyl ester, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a carbamic acid moiety linked to a pyridine derivative. This compound features an amino group that enhances its potential for biological activity, particularly in medicinal chemistry. The presence of the 1,1-dimethylethyl ester group contributes to its stability and solubility in various solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit properties such as being a potential inhibitor or modulator in biochemical pathways, making it of interest in drug development. Its specific interactions and efficacy would depend on its molecular conformation and the presence of functional groups that facilitate binding to biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C11H17N3O2·2ClH
InChI:InChI=1S/C11H17N3O2.2ClH/c1-11(2,3)16-10(15)14-9-6-8(7-12)4-5-13-9;;/h4-6H,7,12H2,1-3H3,(H,13,14,15);2*1H
InChI key:InChIKey=XPXSIFJOJBGGHM-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=CC(CN)=CC=N1.Cl
Synonyms:- Carbamic acid, N-[4-(aminomethyl)-2-pyridinyl]-, 1,1-dimethylethyl ester, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
