CAS 1226808-56-5

2H-Indazole, 4,5,6,7-tetrahydro-5-methyl-, hydrochloride (1:1)

Description:

2H-Indazole, 4,5,6,7-tetrahydro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The tetrahydro designation indicates that the compound has four hydrogen atoms added to the indazole structure, resulting in a saturated form. The presence of a methyl group at the 5-position contributes to its unique properties and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 1226808-56-5, allows for precise identification in chemical databases. Overall, this compound's structural features suggest potential for diverse chemical behavior and applications, particularly in drug development and research.

Formula: C₈H₁₂N₂·ClH

InChI: InChI=1S/C8H12N2.ClH/c1-6-2-3-8-7(4-6)5-9-10-8;/h5-6H,2-4H2,1H3,(H,9,10);1H

InChI key: InChIKey=XIBRZYYINCBWLL-UHFFFAOYSA-N

SMILES: CC1CC=2C(CC1)=NNC2.Cl

Synonyms:

• 2H-Indazole, 4,5,6,7-tetrahydro-5-methyl-, hydrochloride (1:1)

5-Methyl-4,5,6,7-tetrahydro-2H-indazole, HCl

CAS: 1226808-56-5

Formula: C₈H₁₃ClN₂

Molecular weight: 172.6552

Ref: IN-DA0017M9

5-Methyl-4,5,6,7-tetrahydro-2H-indazole hydrochloride

CAS: 1226808-56-5

5-Methyl-4,5,6,7-tetrahydro-2H-indazole hydrochloride

Purity: 97%

Molecular weight: 172.66g/mol

Ref: 54-OR909348