CymitQuimica logo

CAS 1226808-65-6

:

[3,3′-Bipyridine]-5,5′-dicarbonitrile

Description:
[3,3′-Bipyridine]-5,5′-dicarbonitrile is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 3-position. This compound features two cyano groups (-C≡N) located at the 5 and 5' positions of the bipyridine framework, contributing to its chemical reactivity and potential applications in various fields, including materials science and coordination chemistry. The presence of cyano groups enhances the electron-withdrawing properties of the molecule, making it a useful ligand in coordination complexes. Additionally, the bipyridine moiety is known for its ability to participate in π-π stacking interactions, which can influence the physical properties of materials. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as solvent choice and reaction conditions. Overall, [3,3′-Bipyridine]-5,5′-dicarbonitrile is a versatile compound with potential applications in organic synthesis and as a building block for more complex chemical entities.
Formula:C12H6N4
InChI:InChI=1S/C12H6N4/c13-3-9-1-11(7-15-5-9)12-2-10(4-14)6-16-8-12/h1-2,5-8H
InChI key:InChIKey=GCEILXUQPYERQJ-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C=2C=C(C#N)C=NC2
Synonyms:
  • [3,3′-Bipyridine]-5,5′-dicarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.