CAS 1226808-74-7

4-Bromo-6-chloro-2-benzothiazolesulfonic acid

Description:

4-Bromo-6-chloro-2-benzothiazolesulfonic acid is a chemical compound characterized by its unique structure, which includes a benzothiazole ring, a sulfonic acid group, and halogen substituents (bromo and chloro). This compound typically appears as a solid and is soluble in polar solvents due to the presence of the sulfonic acid group, which enhances its hydrophilicity. It is often used in various chemical applications, including as a reagent in organic synthesis and in the development of dyes and pigments. The presence of halogen atoms can influence its reactivity, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Safety data should be consulted, as compounds with halogen substituents can pose health risks, and appropriate handling procedures should be followed. Overall, 4-Bromo-6-chloro-2-benzothiazolesulfonic acid is a versatile compound with significant utility in both industrial and research settings.

Formula: C₇H₃BrClNO₃S₂

InChI: InChI=1S/C7H3BrClNO3S2/c8-4-1-3(9)2-5-6(4)10-7(14-5)15(11,12)13/h1-2H,(H,11,12,13)

InChI key: InChIKey=GQWSIKFJVYXVCT-UHFFFAOYSA-N

SMILES: BrC1=C2C(SC(S(=O)(=O)O)=N2)=CC(Cl)=C1

Synonyms:

• 2-Benzothiazolesulfonic acid, 4-bromo-6-chloro-
• 4-Bromo-6-chloro-2-benzothiazolesulfonic acid

4-Bromo-6-chlorobenzo[d]thiazole-2-sulfonic acid

CAS: 1226808-74-7

Formula: C₇H₃BrClNO₃S₂

Molecular weight: 328.5906

Ref: IN-DA0017MZ